摘要
A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Co, a = 14.0133(14), b = 16.0409(16), c = 30.372(3) A, β = 100.8950(10)°, V = 6704.1(12) A3, Dc = 1.364 g/cm3, Z = 8,μ(MoKa) = 0.704 mml, F(000) = 2840, the final R= 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2′-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2′-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.
A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Co, a = 14.0133(14), b = 16.0409(16), c = 30.372(3) A, β = 100.8950(10)°, V = 6704.1(12) A3, Dc = 1.364 g/cm3, Z = 8,μ(MoKa) = 0.704 mml, F(000) = 2840, the final R= 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2′-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2′-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.
基金
Supported by the Natural Science Foundation of Hunan Province (No. 11JJ9006)
Key Project of Science and Technology Plan of Hunan Province (2012FJ2002)
Science and Technology Plan of Hunan Province (2012GK3031, 2012WK3029)
the Construct Program of Key Discipline in Hunan Province