A new coordination polymer {[Ba（L）（H2o）5]·H2O}n （1, H2L = 3,3＇-（（（（ethane-l,2- diylbis（oxy））-bis（2,1-phenylene））bis（methylene））bis（oxy））dibenzoic acid） has been synthesized under evaporatio...A new coordination polymer {[Ba（L）（H2o）5]·H2O}n （1, H2L = 3,3＇-（（（（ethane-l,2- diylbis（oxy））-bis（2,1-phenylene））bis（methylene））bis（oxy））dibenzoic acid） has been synthesized under evaporation process and characterized by elemental analysis, IR spectra, TG analysis, fluorescence spectrum, powder X-ray diffraction analysis and single-crystal X-ray diffraction. Complex 1 crystallizes in the monoclinic system, space group P21/c, with a = 20.918（5）, b = 7.4539（2）, c = 20.168（5）A, β = 95.486（2）°, V= 3130.1（1） A.3, Z= 4, C30Ha4BaO14, Mr = 755.91, Dc = 1.604 g/cm3, F（000） = 1528,μ = 1.34 mm-1, the final R = 0.0404 and wR = 0.0676 for all data. Single-crystal X-ray structural reveals that the Ba（II） ion adopts a nine-coordinated distorted tricapped trigonal prism coordination geometry. Adjacent Ba（lI） ions are linked by one μ2-L2- anion and two （μ2-H20） water molecules to generate an infinite 1D zigzag chain structure. Then these chains are further linked into a 2D layer supramolecular architecture through O-H…-O hydrogen bonds. Luminescent property and thermal stability of complex I were investigated.展开更多
基金supported by NNSFC(No.21301064)Program for Fundamental Research of Henan Province(132300410413)
文摘A new coordination polymer {[Ba（L）（H2o）5]·H2O}n （1, H2L = 3,3＇-（（（（ethane-l,2- diylbis（oxy））-bis（2,1-phenylene））bis（methylene））bis（oxy））dibenzoic acid） has been synthesized under evaporation process and characterized by elemental analysis, IR spectra, TG analysis, fluorescence spectrum, powder X-ray diffraction analysis and single-crystal X-ray diffraction. Complex 1 crystallizes in the monoclinic system, space group P21/c, with a = 20.918（5）, b = 7.4539（2）, c = 20.168（5）A, β = 95.486（2）°, V= 3130.1（1） A.3, Z= 4, C30Ha4BaO14, Mr = 755.91, Dc = 1.604 g/cm3, F（000） = 1528,μ = 1.34 mm-1, the final R = 0.0404 and wR = 0.0676 for all data. Single-crystal X-ray structural reveals that the Ba（II） ion adopts a nine-coordinated distorted tricapped trigonal prism coordination geometry. Adjacent Ba（lI） ions are linked by one μ2-L2- anion and two （μ2-H20） water molecules to generate an infinite 1D zigzag chain structure. Then these chains are further linked into a 2D layer supramolecular architecture through O-H…-O hydrogen bonds. Luminescent property and thermal stability of complex I were investigated.
